C18H18ClFN6O4S — CID 168835617
[(1R)-1-(2-chlorophenyl)ethyl] N-[5-[3-[fluoro(methyl)sulfamoyl]-2-pyridinyl]-3-methyltriazol-4-yl]carbamate (PubChem CID 168835617) has the molecular formula C18H18ClFN6O4S and a molecular weight of 468.90 g/mol. Its IUPAC name is [(1R)-1-(2-chlorophenyl)ethyl] N-[5-[3-[fluoro(methyl)sulfamoyl]-2-pyridinyl]-3-methyltriazol-4-yl]carbamate.
| Compound Name | [(1R)-1-(2-chlorophenyl)ethyl] N-[5-[3-[fluoro(methyl)sulfamoyl]-2-pyridinyl]-3-methyltriazol-4-yl]carbamate |
|---|---|
| PubChem CID | 168835617 |
| Molecular Formula | C18H18ClFN6O4S |
| Molecular Weight | 468.90 g/mol |
| Exact Mass | 468.08 |
| IUPAC Name | [(1R)-1-(2-chlorophenyl)ethyl] N-[5-[3-[fluoro(methyl)sulfamoyl]-2-pyridinyl]-3-methyltriazol-4-yl]carbamate |
| SMILES | C[C@@H](OC(=O)Nc1c(-c2ncccc2S(=O)(=O)N(C)F)nnn1C)c1ccccc1Cl |
| InChI | InChI=1S/C18H18ClFN6O4S/c1-11(12-7-4-5-8-13(12)19)30-18(27)22-17-16(23-24-25(17)2)15-14(9-6-10-21-15)31(28,29)26(3)20/h4-11H,1-3H3,(H,22,27)/t11-/m1/s1 |
| InChIKey | ZVWUJLPINOOOGP-LLVKDONJSA-N |
| XLogP | 3.35 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.90 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|