About 2-(2,5-dimethylcyclopentyl)-N,N-dimethylethanamine
2-(2,5-dimethylcyclopentyl)-N,N-dimethylethanamine (PubChem CID 168836520) has the molecular formula C11H23N
and a molecular weight of 169.31 g/mol. Its IUPAC name is 2-(2,5-dimethylcyclopentyl)-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-(2,5-dimethylcyclopentyl)-N,N-dimethylethanamine |
| PubChem CID | 168836520 |
| Molecular Formula | C11H23N |
| Molecular Weight | 169.31 g/mol |
| Exact Mass | 169.18 |
| IUPAC Name | 2-(2,5-dimethylcyclopentyl)-N,N-dimethylethanamine |
| SMILES | CC1CCC(C)C1CCN(C)C |
| InChI | InChI=1S/C11H23N/c1-9-5-6-10(2)11(9)7-8-12(3)4/h9-11H,5-8H2,1-4H3 |
| InChIKey | DQORREFMABGJJL-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.31 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(2,5-dimethylcyclopentyl)-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dimethylcyclopentyl)-N,N-dimethylethanamine?
The IUPAC name of 2-(2,5-dimethylcyclopentyl)-N,N-dimethylethanamine (CID 168836520) is 2-(2,5-dimethylcyclopentyl)-N,N-dimethylethanamine.
What is the SMILES notation for 2-(2,5-dimethylcyclopentyl)-N,N-dimethylethanamine?
The canonical SMILES for 2-(2,5-dimethylcyclopentyl)-N,N-dimethylethanamine is CC1CCC(C)C1CCN(C)C.
What is the InChIKey of 2-(2,5-dimethylcyclopentyl)-N,N-dimethylethanamine?
The InChIKey is DQORREFMABGJJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23N/c1-9-5-6-10(2)11(9)7-8-12(3)4/h9-11H,5-8H2,1-4H3.
What are the key properties of 2-(2,5-dimethylcyclopentyl)-N,N-dimethylethanamine?
2-(2,5-dimethylcyclopentyl)-N,N-dimethylethanamine has a molecular weight of 169.31 g/mol, XLogP of 2.62, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dimethylcyclopentyl)-N,N-dimethylethanamine is sourced from PubChem (CID 168836520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).