C6H17ClN2O — CID 174892237
azane;N,N-dimethyl-2-(oxiran-2-yl)ethanamine;hydrochloride (PubChem CID 174892237) has the molecular formula C6H17ClN2O and a molecular weight of 168.67 g/mol. Its IUPAC name is azane;N,N-dimethyl-2-(oxiran-2-yl)ethanamine;hydrochloride.
| Compound Name | azane;N,N-dimethyl-2-(oxiran-2-yl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 174892237 |
| Molecular Formula | C6H17ClN2O |
| Molecular Weight | 168.67 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | azane;N,N-dimethyl-2-(oxiran-2-yl)ethanamine;hydrochloride |
| SMILES | CN(C)CCC1CO1.Cl.N |
| InChI | InChI=1S/C6H13NO.ClH.H3N/c1-7(2)4-3-6-5-8-6;;/h6H,3-5H2,1-2H3;1H;1H3 |
| InChIKey | LAYSTFMDJOQOQJ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 50.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.67 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|