C8H15I2NO2 — CID 175483609
2-(2,5-diiodo-1,3-dioxan-4-yl)-N,N-dimethylethanamine (PubChem CID 175483609) has the molecular formula C8H15I2NO2 and a molecular weight of 411.02 g/mol. Its IUPAC name is 2-(2,5-diiodo-1,3-dioxan-4-yl)-N,N-dimethylethanamine.
| Compound Name | 2-(2,5-diiodo-1,3-dioxan-4-yl)-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 175483609 |
| Molecular Formula | C8H15I2NO2 |
| Molecular Weight | 411.02 g/mol |
| Exact Mass | 410.92 |
| IUPAC Name | 2-(2,5-diiodo-1,3-dioxan-4-yl)-N,N-dimethylethanamine |
| SMILES | CN(C)CCC1OC(I)OCC1I |
| InChI | InChI=1S/C8H15I2NO2/c1-11(2)4-3-7-6(9)5-12-8(10)13-7/h6-8H,3-5H2,1-2H3 |
| InChIKey | FSFOOCWDPVLWHQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.02 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|