C7H13I2NO2 — CID 175908064
2-[(4R)-2,2-diiodo-1,3-dioxolan-4-yl]-N,N-dimethylethanamine (PubChem CID 175908064) has the molecular formula C7H13I2NO2 and a molecular weight of 396.99 g/mol. Its IUPAC name is 2-[(4R)-2,2-diiodo-1,3-dioxolan-4-yl]-N,N-dimethylethanamine.
| Compound Name | 2-[(4R)-2,2-diiodo-1,3-dioxolan-4-yl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 175908064 |
| Molecular Formula | C7H13I2NO2 |
| Molecular Weight | 396.99 g/mol |
| Exact Mass | 396.90 |
| IUPAC Name | 2-[(4R)-2,2-diiodo-1,3-dioxolan-4-yl]-N,N-dimethylethanamine |
| SMILES | CN(C)CC[C@@H]1COC(I)(I)O1 |
| InChI | InChI=1S/C7H13I2NO2/c1-10(2)4-3-6-5-11-7(8,9)12-6/h6H,3-5H2,1-2H3/t6-/m1/s1 |
| InChIKey | PCQDLHRTIGKTGN-ZCFIWIBFSA-N |
| XLogP | 1.83 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.99 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|