C17H38ClNO2 — CID 174594174
N,N-dimethyldodecan-1-amine;oxiran-2-ylmethanol;hydrochloride (PubChem CID 174594174) has the molecular formula C17H38ClNO2 and a molecular weight of 323.95 g/mol. Its IUPAC name is N,N-dimethyldodecan-1-amine;oxiran-2-ylmethanol;hydrochloride.
| Compound Name | N,N-dimethyldodecan-1-amine;oxiran-2-ylmethanol;hydrochloride |
|---|---|
| PubChem CID | 174594174 |
| Molecular Formula | C17H38ClNO2 |
| Molecular Weight | 323.95 g/mol |
| Exact Mass | 323.26 |
| IUPAC Name | N,N-dimethyldodecan-1-amine;oxiran-2-ylmethanol;hydrochloride |
| SMILES | CCCCCCCCCCCCN(C)C.Cl.OCC1CO1 |
| InChI | InChI=1S/C14H31N.C3H6O2.ClH/c1-4-5-6-7-8-9-10-11-12-13-14-15(2)3;4-1-3-2-5-3;/h4-14H2,1-3H3;3-4H,1-2H2;1H |
| InChIKey | MGRDWVRAYSMWRK-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 36.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.95 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|