C49H45N5OTe — CID 168840596
2-[3-[3-(3-tert-butyl-5-phenylphenyl)-2H-imidazo[4,5-b]pyridin-1-yl]phenoxy]-10-(4-tert-butyl-2-pyridinyl)phenotellurazine (PubChem CID 168840596) has the molecular formula C49H45N5OTe and a molecular weight of 847.53 g/mol. Its IUPAC name is 2-[3-[3-(3-tert-butyl-5-phenylphenyl)-2H-imidazo[4,5-b]pyridin-1-yl]phenoxy]-10-(4-tert-butyl-2-pyridinyl)phenotellurazine.
| Compound Name | 2-[3-[3-(3-tert-butyl-5-phenylphenyl)-2H-imidazo[4,5-b]pyridin-1-yl]phenoxy]-10-(4-tert-butyl-2-pyridinyl)phenotellurazine |
|---|---|
| PubChem CID | 168840596 |
| Molecular Formula | C49H45N5OTe |
| Molecular Weight | 847.53 g/mol |
| Exact Mass | 849.27 |
| IUPAC Name | 2-[3-[3-(3-tert-butyl-5-phenylphenyl)-2H-imidazo[4,5-b]pyridin-1-yl]phenoxy]-10-(4-tert-butyl-2-pyridinyl)phenotellurazine |
| SMILES | CC(C)(C)c1cc(-c2ccccc2)cc(N2CN(c3cccc(Oc4ccc5c(c4)N(c4cc(C(C)(C)C)ccn4)c4ccccc4[Te]5)c3)c3cccnc32)c1 |
| InChI | InChI=1S/C49H45N5OTe/c1-48(2,3)35-23-25-50-46(29-35)54-41-18-10-11-20-44(41)56-45-22-21-40(31-43(45)54)55-39-17-12-16-37(30-39)52-32-53(47-42(52)19-13-24-51-47)38-27-34(33-14-8-7-9-15-33)26-36(28-38)49(4,5)6/h7-31H,32H2,1-6H3 |
| InChIKey | SFKTWFFHRAVDKC-UHFFFAOYSA-N |
| XLogP | 11.22 |
| TPSA | 44.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 847.53 |
| LogP ≤ 5 | 11.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|