C39H33N5OSe — CID 168840770
10-(4-tert-butyl-2-pyridinyl)-8-[3-(3-phenyl-2H-benzimidazol-1-yl)phenoxy]pyrido[3,2-b][1,4]benzoselenazine (PubChem CID 168840770) has the molecular formula C39H33N5OSe and a molecular weight of 666.69 g/mol. Its IUPAC name is 10-(4-tert-butyl-2-pyridinyl)-8-[3-(3-phenyl-2H-benzimidazol-1-yl)phenoxy]pyrido[3,2-b][1,4]benzoselenazine.
| Compound Name | 10-(4-tert-butyl-2-pyridinyl)-8-[3-(3-phenyl-2H-benzimidazol-1-yl)phenoxy]pyrido[3,2-b][1,4]benzoselenazine |
|---|---|
| PubChem CID | 168840770 |
| Molecular Formula | C39H33N5OSe |
| Molecular Weight | 666.69 g/mol |
| Exact Mass | 667.19 |
| IUPAC Name | 10-(4-tert-butyl-2-pyridinyl)-8-[3-(3-phenyl-2H-benzimidazol-1-yl)phenoxy]pyrido[3,2-b][1,4]benzoselenazine |
| SMILES | CC(C)(C)c1ccnc(N2c3cc(Oc4cccc(N5CN(c6ccccc6)c6ccccc65)c4)ccc3[Se]c3cccnc32)c1 |
| InChI | InChI=1S/C39H33N5OSe/c1-39(2,3)27-20-22-40-37(23-27)44-34-25-31(18-19-35(34)46-36-17-10-21-41-38(36)44)45-30-14-9-13-29(24-30)43-26-42(28-11-5-4-6-12-28)32-15-7-8-16-33(32)43/h4-25H,26H2,1-3H3 |
| InChIKey | GZFMVSDMJKKKDA-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 44.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.69 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|