C23H31NO6S — CID 16884162
N-[2-(3,4-dimethoxyphenyl)ethyl]-3-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]propane-1-sulfonamide (PubChem CID 16884162) has the molecular formula C23H31NO6S and a molecular weight of 449.57 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-3-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]propane-1-sulfonamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-3-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]propane-1-sulfonamide |
|---|---|
| PubChem CID | 16884162 |
| Molecular Formula | C23H31NO6S |
| Molecular Weight | 449.57 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-3-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]propane-1-sulfonamide |
| SMILES | COc1ccc(CCNS(=O)(=O)CCCOc2cccc3c2OC(C)(C)C3)cc1OC |
| InChI | InChI=1S/C23H31NO6S/c1-23(2)16-18-7-5-8-20(22(18)30-23)29-13-6-14-31(25,26)24-12-11-17-9-10-19(27-3)21(15-17)28-4/h5,7-10,15,24H,6,11-14,16H2,1-4H3 |
| InChIKey | YXKXTOXTXYECOG-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.57 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|