C20H32F3NOSi — CID 168842271
6,6-dimethyl-3-(trifluoromethyl)-1-tri(propan-2-yl)silyl-5,7-dihydroindol-4-one (PubChem CID 168842271) has the molecular formula C20H32F3NOSi and a molecular weight of 387.56 g/mol. Its IUPAC name is 6,6-dimethyl-3-(trifluoromethyl)-1-tri(propan-2-yl)silyl-5,7-dihydroindol-4-one.
| Compound Name | 6,6-dimethyl-3-(trifluoromethyl)-1-tri(propan-2-yl)silyl-5,7-dihydroindol-4-one |
|---|---|
| PubChem CID | 168842271 |
| Molecular Formula | C20H32F3NOSi |
| Molecular Weight | 387.56 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | 6,6-dimethyl-3-(trifluoromethyl)-1-tri(propan-2-yl)silyl-5,7-dihydroindol-4-one |
| SMILES | CC(C)[Si](C(C)C)(C(C)C)n1cc(C(F)(F)F)c2c1CC(C)(C)CC2=O |
| InChI | InChI=1S/C20H32F3NOSi/c1-12(2)26(13(3)4,14(5)6)24-11-15(20(21,22)23)18-16(24)9-19(7,8)10-17(18)25/h11-14H,9-10H2,1-8H3 |
| InChIKey | PUGYMXARRMZSCH-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.56 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|