C19H28O6 — CID 168842386
4-[2-methoxy-5-[4-[(2-methylpropan-2-yl)oxy]-4-oxobutoxy]phenyl]butanoic acid (PubChem CID 168842386) has the molecular formula C19H28O6 and a molecular weight of 352.43 g/mol. Its IUPAC name is 4-[2-methoxy-5-[4-[(2-methylpropan-2-yl)oxy]-4-oxobutoxy]phenyl]butanoic acid.
| Compound Name | 4-[2-methoxy-5-[4-[(2-methylpropan-2-yl)oxy]-4-oxobutoxy]phenyl]butanoic acid |
|---|---|
| PubChem CID | 168842386 |
| Molecular Formula | C19H28O6 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 4-[2-methoxy-5-[4-[(2-methylpropan-2-yl)oxy]-4-oxobutoxy]phenyl]butanoic acid |
| SMILES | COc1ccc(OCCCC(=O)OC(C)(C)C)cc1CCCC(=O)O |
| InChI | InChI=1S/C19H28O6/c1-19(2,3)25-18(22)9-6-12-24-15-10-11-16(23-4)14(13-15)7-5-8-17(20)21/h10-11,13H,5-9,12H2,1-4H3,(H,20,21) |
| InChIKey | VNZIEISUCSCVNR-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|