C76H54N4Si2 — CID 168842556
triphenyl-[4-[2-phenyl-6-[5-(3-triphenylsilylphenyl)indolo[3,2-c]carbazol-12-yl]pyrimidin-4-yl]phenyl]silane (PubChem CID 168842556) has the molecular formula C76H54N4Si2 and a molecular weight of 1079.47 g/mol. Its IUPAC name is triphenyl-[4-[2-phenyl-6-[5-(3-triphenylsilylphenyl)indolo[3,2-c]carbazol-12-yl]pyrimidin-4-yl]phenyl]silane.
| Compound Name | triphenyl-[4-[2-phenyl-6-[5-(3-triphenylsilylphenyl)indolo[3,2-c]carbazol-12-yl]pyrimidin-4-yl]phenyl]silane |
|---|---|
| PubChem CID | 168842556 |
| Molecular Formula | C76H54N4Si2 |
| Molecular Weight | 1079.47 g/mol |
| Exact Mass | 1078.39 |
| IUPAC Name | triphenyl-[4-[2-phenyl-6-[5-(3-triphenylsilylphenyl)indolo[3,2-c]carbazol-12-yl]pyrimidin-4-yl]phenyl]silane |
| SMILES | c1ccc(-c2nc(-c3ccc([Si](c4ccccc4)(c4ccccc4)c4ccccc4)cc3)cc(-n3c4ccccc4c4ccc5c(c6ccccc6n5-c5cccc([Si](c6ccccc6)(c6ccccc6)c6ccccc6)c5)c43)n2)cc1 |
| InChI | InChI=1S/C76H54N4Si2/c1-8-27-56(28-9-1)76-77-69(55-47-49-64(50-48-55)81(58-30-10-2-11-31-58,59-32-12-3-13-33-59)60-34-14-4-15-35-60)54-73(78-76)80-70-45-24-22-43-66(70)67-51-52-72-74(75(67)80)68-44-23-25-46-71(68)79(72)57-29-26-42-65(53-57)82(61-36-16-5-17-37-61,62-38-18-6-19-39-62)63-40-20-7-21-41-63/h1-54H |
| InChIKey | XHMUEZQTALQISV-UHFFFAOYSA-N |
| XLogP | 12.76 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 82 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1079.47 |
| LogP ≤ 5 | 12.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|