C39H29N2O2Pt- — CID 168843908
2-[2-[3-(3H-dibenzofuran-3-id-4-yl)isoquinolin-1-yl]ethyl]-6-(3,3-dimethylindol-2-yl)phenol;platinum (PubChem CID 168843908) has the molecular formula C39H29N2O2Pt- and a molecular weight of 752.75 g/mol. Its IUPAC name is 2-[2-[3-(3H-dibenzofuran-3-id-4-yl)isoquinolin-1-yl]ethyl]-6-(3,3-dimethylindol-2-yl)phenol;platinum.
| Compound Name | 2-[2-[3-(3H-dibenzofuran-3-id-4-yl)isoquinolin-1-yl]ethyl]-6-(3,3-dimethylindol-2-yl)phenol;platinum |
|---|---|
| PubChem CID | 168843908 |
| Molecular Formula | C39H29N2O2Pt- |
| Molecular Weight | 752.75 g/mol |
| Exact Mass | 752.19 |
| IUPAC Name | 2-[2-[3-(3H-dibenzofuran-3-id-4-yl)isoquinolin-1-yl]ethyl]-6-(3,3-dimethylindol-2-yl)phenol;platinum |
| SMILES | CC1(C)C(c2cccc(CCc3nc(-c4[c-]ccc5c4oc4ccccc45)cc4ccccc34)c2O)=Nc2ccccc21.[Pt] |
| InChI | InChI=1S/C39H29N2O2.Pt/c1-39(2)31-18-6-7-19-33(31)41-38(39)30-17-9-12-24(36(30)42)21-22-32-26-13-4-3-11-25(26)23-34(40-32)29-16-10-15-28-27-14-5-8-20-35(27)43-37(28)29;/h3-15,17-20,23,42H,21-22H2,1-2H3;/q-1; |
| InChIKey | HFWUQSOAZLLGKM-UHFFFAOYSA-N |
| XLogP | 9.50 |
| TPSA | 58.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.75 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|