C13H10N8S — CID 168846052
5-isocyano-2-methylsulfanyl-N-[2-(2H-tetrazol-5-yl)phenyl]pyrimidin-4-amine (PubChem CID 168846052) has the molecular formula C13H10N8S and a molecular weight of 310.35 g/mol. Its IUPAC name is 5-isocyano-2-methylsulfanyl-N-[2-(2H-tetrazol-5-yl)phenyl]pyrimidin-4-amine.
| Compound Name | 5-isocyano-2-methylsulfanyl-N-[2-(2H-tetrazol-5-yl)phenyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 168846052 |
| Molecular Formula | C13H10N8S |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 5-isocyano-2-methylsulfanyl-N-[2-(2H-tetrazol-5-yl)phenyl]pyrimidin-4-amine |
| SMILES | [C-]#[N+]c1cnc(SC)nc1Nc1ccccc1-c1nn[nH]n1 |
| InChI | InChI=1S/C13H10N8S/c1-14-10-7-15-13(22-2)17-12(10)16-9-6-4-3-5-8(9)11-18-20-21-19-11/h3-7H,2H3,(H,15,16,17)(H,18,19,20,21) |
| InChIKey | IMZQGCLJKJXSLO-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 96.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|