C16H11N7 — CID 173146131
2-phenyl-4-[2-(2H-tetrazol-5-yl)phenyl]-1,3,5-triazine (PubChem CID 173146131) has the molecular formula C16H11N7 and a molecular weight of 301.31 g/mol. Its IUPAC name is 2-phenyl-4-[2-(2H-tetrazol-5-yl)phenyl]-1,3,5-triazine.
| Compound Name | 2-phenyl-4-[2-(2H-tetrazol-5-yl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 173146131 |
| Molecular Formula | C16H11N7 |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 2-phenyl-4-[2-(2H-tetrazol-5-yl)phenyl]-1,3,5-triazine |
| SMILES | c1ccc(-c2ncnc(-c3ccccc3-c3nn[nH]n3)n2)cc1 |
| InChI | InChI=1S/C16H11N7/c1-2-6-11(7-3-1)14-17-10-18-15(19-14)12-8-4-5-9-13(12)16-20-22-23-21-16/h1-10H,(H,20,21,22,23) |
| InChIKey | WTSYATVNFVEBCW-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 93.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |