C14H14N4O — CID 172761418
5-(2-methyl-6-phenylphenyl)-2H-tetrazole;hydrate (PubChem CID 172761418) has the molecular formula C14H14N4O and a molecular weight of 254.29 g/mol. Its IUPAC name is 5-(2-methyl-6-phenylphenyl)-2H-tetrazole;hydrate.
| Compound Name | 5-(2-methyl-6-phenylphenyl)-2H-tetrazole;hydrate |
|---|---|
| PubChem CID | 172761418 |
| Molecular Formula | C14H14N4O |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 5-(2-methyl-6-phenylphenyl)-2H-tetrazole;hydrate |
| SMILES | Cc1cccc(-c2ccccc2)c1-c1nn[nH]n1.O |
| InChI | InChI=1S/C14H12N4.H2O/c1-10-6-5-9-12(11-7-3-2-4-8-11)13(10)14-15-17-18-16-14;/h2-9H,1H3,(H,15,16,17,18);1H2 |
| InChIKey | LSTAZNRGEVKCPL-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 85.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |