C27H22O5S2 — CID 168849132
(2-oxochromen-7-yl) 2-[(2,2-dimethyl-3-phenylpropanoyl)disulfanyl]benzoate (PubChem CID 168849132) has the molecular formula C27H22O5S2 and a molecular weight of 490.60 g/mol. Its IUPAC name is (2-oxochromen-7-yl) 2-[(2,2-dimethyl-3-phenylpropanoyl)disulfanyl]benzoate.
| Compound Name | (2-oxochromen-7-yl) 2-[(2,2-dimethyl-3-phenylpropanoyl)disulfanyl]benzoate |
|---|---|
| PubChem CID | 168849132 |
| Molecular Formula | C27H22O5S2 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.09 |
| IUPAC Name | (2-oxochromen-7-yl) 2-[(2,2-dimethyl-3-phenylpropanoyl)disulfanyl]benzoate |
| SMILES | CC(C)(Cc1ccccc1)C(=O)SSc1ccccc1C(=O)Oc1ccc2ccc(=O)oc2c1 |
| InChI | InChI=1S/C27H22O5S2/c1-27(2,17-18-8-4-3-5-9-18)26(30)34-33-23-11-7-6-10-21(23)25(29)31-20-14-12-19-13-15-24(28)32-22(19)16-20/h3-16H,17H2,1-2H3 |
| InChIKey | LWALSZMHFLGLTH-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 73.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|