C22H23FN4O4S — CID 16885019
4-[3-(4-fluorophenyl)-6-oxopyridazin-1-yl]-N-[2-(4-sulfamoylphenyl)ethyl]butanamide (PubChem CID 16885019) has the molecular formula C22H23FN4O4S and a molecular weight of 458.52 g/mol. Its IUPAC name is 4-[3-(4-fluorophenyl)-6-oxopyridazin-1-yl]-N-[2-(4-sulfamoylphenyl)ethyl]butanamide.
| Compound Name | 4-[3-(4-fluorophenyl)-6-oxopyridazin-1-yl]-N-[2-(4-sulfamoylphenyl)ethyl]butanamide |
|---|---|
| PubChem CID | 16885019 |
| Molecular Formula | C22H23FN4O4S |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | 4-[3-(4-fluorophenyl)-6-oxopyridazin-1-yl]-N-[2-(4-sulfamoylphenyl)ethyl]butanamide |
| SMILES | NS(=O)(=O)c1ccc(CCNC(=O)CCCn2nc(-c3ccc(F)cc3)ccc2=O)cc1 |
| InChI | InChI=1S/C22H23FN4O4S/c23-18-7-5-17(6-8-18)20-11-12-22(29)27(26-20)15-1-2-21(28)25-14-13-16-3-9-19(10-4-16)32(24,30)31/h3-12H,1-2,13-15H2,(H,25,28)(H2,24,30,31) |
| InChIKey | IZIQZXOSHATACW-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 124.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |