C23H26N4O5S — CID 16885174
4-[3-(4-methoxyphenyl)-6-oxopyridazin-1-yl]-N-[2-(4-sulfamoylphenyl)ethyl]butanamide (PubChem CID 16885174) has the molecular formula C23H26N4O5S and a molecular weight of 470.55 g/mol. Its IUPAC name is 4-[3-(4-methoxyphenyl)-6-oxopyridazin-1-yl]-N-[2-(4-sulfamoylphenyl)ethyl]butanamide.
| Compound Name | 4-[3-(4-methoxyphenyl)-6-oxopyridazin-1-yl]-N-[2-(4-sulfamoylphenyl)ethyl]butanamide |
|---|---|
| PubChem CID | 16885174 |
| Molecular Formula | C23H26N4O5S |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | 4-[3-(4-methoxyphenyl)-6-oxopyridazin-1-yl]-N-[2-(4-sulfamoylphenyl)ethyl]butanamide |
| SMILES | COc1ccc(-c2ccc(=O)n(CCCC(=O)NCCc3ccc(S(N)(=O)=O)cc3)n2)cc1 |
| InChI | InChI=1S/C23H26N4O5S/c1-32-19-8-6-18(7-9-19)21-12-13-23(29)27(26-21)16-2-3-22(28)25-15-14-17-4-10-20(11-5-17)33(24,30)31/h4-13H,2-3,14-16H2,1H3,(H,25,28)(H2,24,30,31) |
| InChIKey | SBDXLMWPSSKDRR-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 133.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |