C13H10ClFO4S — CID 168854602
ethyl 2-(7-chloro-8-fluoro-4-oxo-2,3-dihydrothiochromen-3-yl)-2-oxoacetate (PubChem CID 168854602) has the molecular formula C13H10ClFO4S and a molecular weight of 316.74 g/mol. Its IUPAC name is ethyl 2-(7-chloro-8-fluoro-4-oxo-2,3-dihydrothiochromen-3-yl)-2-oxoacetate.
| Compound Name | ethyl 2-(7-chloro-8-fluoro-4-oxo-2,3-dihydrothiochromen-3-yl)-2-oxoacetate |
|---|---|
| PubChem CID | 168854602 |
| Molecular Formula | C13H10ClFO4S |
| Molecular Weight | 316.74 g/mol |
| Exact Mass | 316.00 |
| IUPAC Name | ethyl 2-(7-chloro-8-fluoro-4-oxo-2,3-dihydrothiochromen-3-yl)-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)C1CSc2c(ccc(Cl)c2F)C1=O |
| InChI | InChI=1S/C13H10ClFO4S/c1-2-19-13(18)11(17)7-5-20-12-6(10(7)16)3-4-8(14)9(12)15/h3-4,7H,2,5H2,1H3 |
| InChIKey | DHICPCNCAQHLPC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.74 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|