C13H11FO6S — CID 66580903
ethyl 2-(7-fluoro-1,1,4-trioxo-2,3-dihydrothiochromen-3-yl)-2-oxoacetate (PubChem CID 66580903) has the molecular formula C13H11FO6S and a molecular weight of 314.29 g/mol. Its IUPAC name is ethyl 2-(7-fluoro-1,1,4-trioxo-2,3-dihydrothiochromen-3-yl)-2-oxoacetate.
| Compound Name | ethyl 2-(7-fluoro-1,1,4-trioxo-2,3-dihydrothiochromen-3-yl)-2-oxoacetate |
|---|---|
| PubChem CID | 66580903 |
| Molecular Formula | C13H11FO6S |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | ethyl 2-(7-fluoro-1,1,4-trioxo-2,3-dihydrothiochromen-3-yl)-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)C1CS(=O)(=O)c2cc(F)ccc2C1=O |
| InChI | InChI=1S/C13H11FO6S/c1-2-20-13(17)12(16)9-6-21(18,19)10-5-7(14)3-4-8(10)11(9)15/h3-5,9H,2,6H2,1H3 |
| InChIKey | FKEDMNHGYJGUTE-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|