C19H17ClN2OSe — CID 168858746
5-[(4-chlorophenyl)methylidene]-1-methyl-3-(2-phenylethyl)-2-selanylideneimidazolidin-4-one (PubChem CID 168858746) has the molecular formula C19H17ClN2OSe and a molecular weight of 403.77 g/mol. Its IUPAC name is 5-[(4-chlorophenyl)methylidene]-1-methyl-3-(2-phenylethyl)-2-selanylideneimidazolidin-4-one.
| Compound Name | 5-[(4-chlorophenyl)methylidene]-1-methyl-3-(2-phenylethyl)-2-selanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 168858746 |
| Molecular Formula | C19H17ClN2OSe |
| Molecular Weight | 403.77 g/mol |
| Exact Mass | 404.02 |
| IUPAC Name | 5-[(4-chlorophenyl)methylidene]-1-methyl-3-(2-phenylethyl)-2-selanylideneimidazolidin-4-one |
| SMILES | CN1C(=[Se])N(CCc2ccccc2)C(=O)C1=Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H17ClN2OSe/c1-21-17(13-15-7-9-16(20)10-8-15)18(23)22(19(21)24)12-11-14-5-3-2-4-6-14/h2-10,13H,11-12H2,1H3 |
| InChIKey | QOMWISOSBSJSSI-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.77 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|