C20H22ClN3O2S — CID 168861147
6-(2-chloro-4-methylphenyl)-3-(2-morpholin-4-ylethyl)-1H-2,1,3-benzothiadiazin-4-one (PubChem CID 168861147) has the molecular formula C20H22ClN3O2S and a molecular weight of 403.94 g/mol. Its IUPAC name is 6-(2-chloro-4-methylphenyl)-3-(2-morpholin-4-ylethyl)-1H-2,1,3-benzothiadiazin-4-one.
| Compound Name | 6-(2-chloro-4-methylphenyl)-3-(2-morpholin-4-ylethyl)-1H-2,1,3-benzothiadiazin-4-one |
|---|---|
| PubChem CID | 168861147 |
| Molecular Formula | C20H22ClN3O2S |
| Molecular Weight | 403.94 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 6-(2-chloro-4-methylphenyl)-3-(2-morpholin-4-ylethyl)-1H-2,1,3-benzothiadiazin-4-one |
| SMILES | Cc1ccc(-c2ccc3c(c2)C(=O)N(CCN2CCOCC2)SN3)c(Cl)c1 |
| InChI | InChI=1S/C20H22ClN3O2S/c1-14-2-4-16(18(21)12-14)15-3-5-19-17(13-15)20(25)24(27-22-19)7-6-23-8-10-26-11-9-23/h2-5,12-13,22H,6-11H2,1H3 |
| InChIKey | ZMAAURWZTQYWAK-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.94 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|