C23H25N5O3 — CID 168861886
N-cyclohexyl-N'-[4-(1,3-oxazol-5-yl)phenyl]-N'-(1-pyrimidin-5-ylethyl)oxamide (PubChem CID 168861886) has the molecular formula C23H25N5O3 and a molecular weight of 419.49 g/mol. Its IUPAC name is N-cyclohexyl-N'-[4-(1,3-oxazol-5-yl)phenyl]-N'-(1-pyrimidin-5-ylethyl)oxamide.
| Compound Name | N-cyclohexyl-N'-[4-(1,3-oxazol-5-yl)phenyl]-N'-(1-pyrimidin-5-ylethyl)oxamide |
|---|---|
| PubChem CID | 168861886 |
| Molecular Formula | C23H25N5O3 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | N-cyclohexyl-N'-[4-(1,3-oxazol-5-yl)phenyl]-N'-(1-pyrimidin-5-ylethyl)oxamide |
| SMILES | CC(c1cncnc1)N(C(=O)C(=O)NC1CCCCC1)c1ccc(-c2cnco2)cc1 |
| InChI | InChI=1S/C23H25N5O3/c1-16(18-11-24-14-25-12-18)28(23(30)22(29)27-19-5-3-2-4-6-19)20-9-7-17(8-10-20)21-13-26-15-31-21/h7-16,19H,2-6H2,1H3,(H,27,29) |
| InChIKey | PNQGNYKGAOGMAA-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 101.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|