C26H23FN6O4 — CID 168865854
N-[5-cyano-4-(2-methoxyethylamino)-2-pyridinyl]-6-(2-fluoro-6-methoxyphenyl)-5-formyl-1-methylpyrrolo[3,2-b]pyridine-3-carboxamide (PubChem CID 168865854) has the molecular formula C26H23FN6O4 and a molecular weight of 502.51 g/mol. Its IUPAC name is N-[5-cyano-4-(2-methoxyethylamino)-2-pyridinyl]-6-(2-fluoro-6-methoxyphenyl)-5-formyl-1-methylpyrrolo[3,2-b]pyridine-3-carboxamide.
| Compound Name | N-[5-cyano-4-(2-methoxyethylamino)-2-pyridinyl]-6-(2-fluoro-6-methoxyphenyl)-5-formyl-1-methylpyrrolo[3,2-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 168865854 |
| Molecular Formula | C26H23FN6O4 |
| Molecular Weight | 502.51 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | N-[5-cyano-4-(2-methoxyethylamino)-2-pyridinyl]-6-(2-fluoro-6-methoxyphenyl)-5-formyl-1-methylpyrrolo[3,2-b]pyridine-3-carboxamide |
| SMILES | COCCNc1cc(NC(=O)c2cn(C)c3cc(-c4c(F)cccc4OC)c(C=O)nc23)ncc1C#N |
| InChI | InChI=1S/C26H23FN6O4/c1-33-13-17(26(35)32-23-10-19(29-7-8-36-2)15(11-28)12-30-23)25-21(33)9-16(20(14-34)31-25)24-18(27)5-4-6-22(24)37-3/h4-6,9-10,12-14H,7-8H2,1-3H3,(H2,29,30,32,35) |
| InChIKey | YNDIZVSRTQUFGU-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 131.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.51 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|