C12H13ClF2N2 — CID 168866004
2-(2,6-difluorophenyl)piperidine-4-carbonitrile;hydrochloride (PubChem CID 168866004) has the molecular formula C12H13ClF2N2 and a molecular weight of 258.70 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)piperidine-4-carbonitrile;hydrochloride.
| Compound Name | 2-(2,6-difluorophenyl)piperidine-4-carbonitrile;hydrochloride |
|---|---|
| PubChem CID | 168866004 |
| Molecular Formula | C12H13ClF2N2 |
| Molecular Weight | 258.70 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 2-(2,6-difluorophenyl)piperidine-4-carbonitrile;hydrochloride |
| SMILES | Cl.N#CC1CCNC(c2c(F)cccc2F)C1 |
| InChI | InChI=1S/C12H12F2N2.ClH/c13-9-2-1-3-10(14)12(9)11-6-8(7-15)4-5-16-11;/h1-3,8,11,16H,4-6H2;1H |
| InChIKey | CLMRLBRPGAFAMD-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.70 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |