C13H16F2N2 — CID 123206718
2-(2,6-difluorophenyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[3,2-c]pyridine (PubChem CID 123206718) has the molecular formula C13H16F2N2 and a molecular weight of 238.28 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[3,2-c]pyridine.
| Compound Name | 2-(2,6-difluorophenyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[3,2-c]pyridine |
|---|---|
| PubChem CID | 123206718 |
| Molecular Formula | C13H16F2N2 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 2-(2,6-difluorophenyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[3,2-c]pyridine |
| SMILES | Fc1cccc(F)c1C1CC2CNCCC2N1 |
| InChI | InChI=1S/C13H16F2N2/c14-9-2-1-3-10(15)13(9)12-6-8-7-16-5-4-11(8)17-12/h1-3,8,11-12,16-17H,4-7H2 |
| InChIKey | XHPNXJYPGLMACH-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |