C16H29N3O2 — CID 16886799
N-[(1-cyclopentylpiperidin-4-yl)methyl]-N'-propan-2-yloxamide (PubChem CID 16886799) has the molecular formula C16H29N3O2 and a molecular weight of 295.43 g/mol. Its IUPAC name is N-[(1-cyclopentylpiperidin-4-yl)methyl]-N'-propan-2-yloxamide.
| Compound Name | N-[(1-cyclopentylpiperidin-4-yl)methyl]-N'-propan-2-yloxamide |
|---|---|
| PubChem CID | 16886799 |
| Molecular Formula | C16H29N3O2 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | N-[(1-cyclopentylpiperidin-4-yl)methyl]-N'-propan-2-yloxamide |
| SMILES | CC(C)NC(=O)C(=O)NCC1CCN(C2CCCC2)CC1 |
| InChI | InChI=1S/C16H29N3O2/c1-12(2)18-16(21)15(20)17-11-13-7-9-19(10-8-13)14-5-3-4-6-14/h12-14H,3-11H2,1-2H3,(H,17,20)(H,18,21) |
| InChIKey | GAUWXPARFARECC-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|