C20H35N3O3 — CID 121109651
N'-cycloheptyl-N-[[1-(oxan-4-yl)piperidin-4-yl]methyl]oxamide (PubChem CID 121109651) has the molecular formula C20H35N3O3 and a molecular weight of 365.52 g/mol. Its IUPAC name is N'-cycloheptyl-N-[[1-(oxan-4-yl)piperidin-4-yl]methyl]oxamide.
| Compound Name | N'-cycloheptyl-N-[[1-(oxan-4-yl)piperidin-4-yl]methyl]oxamide |
|---|---|
| PubChem CID | 121109651 |
| Molecular Formula | C20H35N3O3 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.27 |
| IUPAC Name | N'-cycloheptyl-N-[[1-(oxan-4-yl)piperidin-4-yl]methyl]oxamide |
| SMILES | O=C(NCC1CCN(C2CCOCC2)CC1)C(=O)NC1CCCCCC1 |
| InChI | InChI=1S/C20H35N3O3/c24-19(20(25)22-17-5-3-1-2-4-6-17)21-15-16-7-11-23(12-8-16)18-9-13-26-14-10-18/h16-18H,1-15H2,(H,21,24)(H,22,25) |
| InChIKey | OMJXBPJVOANKNS-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|