C29H23ClFN5O5 — CID 168872606
3-[6-[[4-(3-chloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]oxymethyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 168872606) has the molecular formula C29H23ClFN5O5 and a molecular weight of 575.98 g/mol. Its IUPAC name is 3-[6-[[4-(3-chloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]oxymethyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[[4-(3-chloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]oxymethyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 168872606 |
| Molecular Formula | C29H23ClFN5O5 |
| Molecular Weight | 575.98 g/mol |
| Exact Mass | 575.14 |
| IUPAC Name | 3-[6-[[4-(3-chloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]oxymethyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | COc1cc2ncnc(Nc3cccc(Cl)c3F)c2cc1OCc1ccc2c(c1)CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C29H23ClFN5O5/c1-40-23-11-21-18(27(33-14-32-21)34-20-4-2-3-19(30)26(20)31)10-24(23)41-13-15-5-6-17-16(9-15)12-36(29(17)39)22-7-8-25(37)35-28(22)38/h2-6,9-11,14,22H,7-8,12-13H2,1H3,(H,32,33,34)(H,35,37,38) |
| InChIKey | LOYMHEQKPZEFKL-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 122.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.98 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|