C34H29Cl2FN6O6 — CID 168871244
5-[[4-[4-(3,4-dichloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 168871244) has the molecular formula C34H29Cl2FN6O6 and a molecular weight of 707.55 g/mol. Its IUPAC name is 5-[[4-[4-(3,4-dichloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 5-[[4-[4-(3,4-dichloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 168871244 |
| Molecular Formula | C34H29Cl2FN6O6 |
| Molecular Weight | 707.55 g/mol |
| Exact Mass | 706.15 |
| IUPAC Name | 5-[[4-[4-(3,4-dichloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | COc1cc2ncnc(Nc3ccc(Cl)c(Cl)c3F)c2cc1OC1CCN(Cc2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3=O)CC1 |
| InChI | InChI=1S/C34H29Cl2FN6O6/c1-48-26-14-24-21(31(39-16-38-24)40-23-5-4-22(35)29(36)30(23)37)13-27(26)49-18-8-10-42(11-9-18)15-17-2-3-19-20(12-17)34(47)43(33(19)46)25-6-7-28(44)41-32(25)45/h2-5,12-14,16,18,25H,6-11,15H2,1H3,(H,38,39,40)(H,41,44,45) |
| InChIKey | YTBVRGWNZWTGBT-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 143.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.55 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|