C22H29N3O — CID 168873681
5-[[2-(cyclopropylmethyl)-3,4-dihydro-1H-isoquinolin-7-yl]-(1,1,1,3,3-pentadeuteriopropan-2-yl)amino]-1-(dideuteriomethyl)pyridin-2-one (PubChem CID 168873681) has the molecular formula C22H29N3O and a molecular weight of 358.54 g/mol. Its IUPAC name is 5-[[2-(cyclopropylmethyl)-3,4-dihydro-1H-isoquinolin-7-yl]-(1,1,1,3,3-pentadeuteriopropan-2-yl)amino]-1-(dideuteriomethyl)pyridin-2-one.
| Compound Name | 5-[[2-(cyclopropylmethyl)-3,4-dihydro-1H-isoquinolin-7-yl]-(1,1,1,3,3-pentadeuteriopropan-2-yl)amino]-1-(dideuteriomethyl)pyridin-2-one |
|---|---|
| PubChem CID | 168873681 |
| Molecular Formula | C22H29N3O |
| Molecular Weight | 358.54 g/mol |
| Exact Mass | 358.27 |
| IUPAC Name | 5-[[2-(cyclopropylmethyl)-3,4-dihydro-1H-isoquinolin-7-yl]-(1,1,1,3,3-pentadeuteriopropan-2-yl)amino]-1-(dideuteriomethyl)pyridin-2-one |
| SMILES | [2H]C([2H])C(N(c1ccc2c(c1)CN(CC1CC1)CC2)c1ccc(=O)n(C([2H])[2H])c1)C([2H])([2H])[2H] |
| InChI | InChI=1S/C22H29N3O/c1-16(2)25(21-8-9-22(26)23(3)15-21)20-7-6-18-10-11-24(13-17-4-5-17)14-19(18)12-20/h6-9,12,15-17H,4-5,10-11,13-14H2,1-3H3/i1D2,2D3,3D2 |
| InChIKey | WTJQIUVEDTZURU-HUORPNEISA-N |
| XLogP | 3.70 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.54 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |