C11H12FN3O3 — CID 168873817
5-fluoro-2-methoxy-3-[5-(methoxymethyl)-1,2,4-oxadiazol-3-yl]aniline (PubChem CID 168873817) has the molecular formula C11H12FN3O3 and a molecular weight of 253.23 g/mol. Its IUPAC name is 5-fluoro-2-methoxy-3-[5-(methoxymethyl)-1,2,4-oxadiazol-3-yl]aniline.
| Compound Name | 5-fluoro-2-methoxy-3-[5-(methoxymethyl)-1,2,4-oxadiazol-3-yl]aniline |
|---|---|
| PubChem CID | 168873817 |
| Molecular Formula | C11H12FN3O3 |
| Molecular Weight | 253.23 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 5-fluoro-2-methoxy-3-[5-(methoxymethyl)-1,2,4-oxadiazol-3-yl]aniline |
| SMILES | COCc1nc(-c2cc(F)cc(N)c2OC)no1 |
| InChI | InChI=1S/C11H12FN3O3/c1-16-5-9-14-11(15-18-9)7-3-6(12)4-8(13)10(7)17-2/h3-4H,5,13H2,1-2H3 |
| InChIKey | AZCFHLWISUHEJC-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.23 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|