C10H6BrF3N2O2 — CID 87077802
5-(bromomethyl)-3-(3,4,5-trifluoro-2-methoxyphenyl)-1,2,4-oxadiazole (PubChem CID 87077802) has the molecular formula C10H6BrF3N2O2 and a molecular weight of 323.07 g/mol. Its IUPAC name is 5-(bromomethyl)-3-(3,4,5-trifluoro-2-methoxyphenyl)-1,2,4-oxadiazole.
| Compound Name | 5-(bromomethyl)-3-(3,4,5-trifluoro-2-methoxyphenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 87077802 |
| Molecular Formula | C10H6BrF3N2O2 |
| Molecular Weight | 323.07 g/mol |
| Exact Mass | 321.96 |
| IUPAC Name | 5-(bromomethyl)-3-(3,4,5-trifluoro-2-methoxyphenyl)-1,2,4-oxadiazole |
| SMILES | COc1c(-c2noc(CBr)n2)cc(F)c(F)c1F |
| InChI | InChI=1S/C10H6BrF3N2O2/c1-17-9-4(2-5(12)7(13)8(9)14)10-15-6(3-11)18-16-10/h2H,3H2,1H3 |
| InChIKey | XJUQOEAHFDDYCS-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.07 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|