C19H30BNO3 — CID 168875034
N-[[2,6-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-3-methyloxetan-3-amine (PubChem CID 168875034) has the molecular formula C19H30BNO3 and a molecular weight of 331.27 g/mol. Its IUPAC name is N-[[2,6-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-3-methyloxetan-3-amine.
| Compound Name | N-[[2,6-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-3-methyloxetan-3-amine |
|---|---|
| PubChem CID | 168875034 |
| Molecular Formula | C19H30BNO3 |
| Molecular Weight | 331.27 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | N-[[2,6-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-3-methyloxetan-3-amine |
| SMILES | Cc1cc(B2OC(C)(C)C(C)(C)O2)cc(C)c1CNC1(C)COC1 |
| InChI | InChI=1S/C19H30BNO3/c1-13-8-15(20-23-17(3,4)18(5,6)24-20)9-14(2)16(13)10-21-19(7)11-22-12-19/h8-9,21H,10-12H2,1-7H3 |
| InChIKey | RKQBONNSIBWJEM-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.27 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|