C30H30N4O2 — CID 168876269
1-[2-[4-(dimethylaminooxy)phenyl]ethyl]-N-(2,6-dimethylphenyl)-9H-pyrido[3,4-b]indole-3-carboxamide (PubChem CID 168876269) has the molecular formula C30H30N4O2 and a molecular weight of 478.60 g/mol. Its IUPAC name is 1-[2-[4-(dimethylaminooxy)phenyl]ethyl]-N-(2,6-dimethylphenyl)-9H-pyrido[3,4-b]indole-3-carboxamide.
| Compound Name | 1-[2-[4-(dimethylaminooxy)phenyl]ethyl]-N-(2,6-dimethylphenyl)-9H-pyrido[3,4-b]indole-3-carboxamide |
|---|---|
| PubChem CID | 168876269 |
| Molecular Formula | C30H30N4O2 |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | 1-[2-[4-(dimethylaminooxy)phenyl]ethyl]-N-(2,6-dimethylphenyl)-9H-pyrido[3,4-b]indole-3-carboxamide |
| SMILES | Cc1cccc(C)c1NC(=O)c1cc2c([nH]c3ccccc32)c(CCc2ccc(ON(C)C)cc2)n1 |
| InChI | InChI=1S/C30H30N4O2/c1-19-8-7-9-20(2)28(19)33-30(35)27-18-24-23-10-5-6-11-25(23)32-29(24)26(31-27)17-14-21-12-15-22(16-13-21)36-34(3)4/h5-13,15-16,18,32H,14,17H2,1-4H3,(H,33,35) |
| InChIKey | BQWQQHHVJGIWAL-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|