C15H24N2O2 — CID 168876627
(2S)-3-[(3-amino-6,7,8,9-tetrahydro-5H-benzo[7]annulen-7-yl)-methylamino]propane-1,2-diol (PubChem CID 168876627) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is (2S)-3-[(3-amino-6,7,8,9-tetrahydro-5H-benzo[7]annulen-7-yl)-methylamino]propane-1,2-diol.
| Compound Name | (2S)-3-[(3-amino-6,7,8,9-tetrahydro-5H-benzo[7]annulen-7-yl)-methylamino]propane-1,2-diol |
|---|---|
| PubChem CID | 168876627 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | (2S)-3-[(3-amino-6,7,8,9-tetrahydro-5H-benzo[7]annulen-7-yl)-methylamino]propane-1,2-diol |
| SMILES | CN(C[C@H](O)CO)C1CCc2ccc(N)cc2CC1 |
| InChI | InChI=1S/C15H24N2O2/c1-17(9-15(19)10-18)14-6-3-11-2-5-13(16)8-12(11)4-7-14/h2,5,8,14-15,18-19H,3-4,6-7,9-10,16H2,1H3/t14?,15-/m0/s1 |
| InChIKey | XVBMPZGMIZBZJG-LOACHALJSA-N |
| XLogP | 0.80 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|