C26H36O4 — CID 168877641
6-[3-ethenyl-2-(4-prop-2-enoyloxyhexyl)phenyl]hexan-3-yl prop-2-enoate (PubChem CID 168877641) has the molecular formula C26H36O4 and a molecular weight of 412.57 g/mol. Its IUPAC name is 6-[3-ethenyl-2-(4-prop-2-enoyloxyhexyl)phenyl]hexan-3-yl prop-2-enoate.
| Compound Name | 6-[3-ethenyl-2-(4-prop-2-enoyloxyhexyl)phenyl]hexan-3-yl prop-2-enoate |
|---|---|
| PubChem CID | 168877641 |
| Molecular Formula | C26H36O4 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | 6-[3-ethenyl-2-(4-prop-2-enoyloxyhexyl)phenyl]hexan-3-yl prop-2-enoate |
| SMILES | C=CC(=O)OC(CC)CCCc1cccc(C=C)c1CCCC(CC)OC(=O)C=C |
| InChI | InChI=1S/C26H36O4/c1-6-20-14-11-15-21(16-12-17-22(7-2)29-25(27)9-4)24(20)19-13-18-23(8-3)30-26(28)10-5/h6,9-11,14-15,22-23H,1,4-5,7-8,12-13,16-19H2,2-3H3 |
| InChIKey | CSNSTMUBEGXVEQ-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|