About 4-prop-2-enoyloxyhexyl benzoate
4-prop-2-enoyloxyhexyl benzoate (PubChem CID 175019274) has the molecular formula C16H20O4
and a molecular weight of 276.33 g/mol. Its IUPAC name is 4-prop-2-enoyloxyhexyl benzoate.
Molecular Properties
| Compound Name | 4-prop-2-enoyloxyhexyl benzoate |
| PubChem CID | 175019274 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 4-prop-2-enoyloxyhexyl benzoate |
| SMILES | C=CC(=O)OC(CC)CCCOC(=O)c1ccccc1 |
| InChI | InChI=1S/C16H20O4/c1-3-14(20-15(17)4-2)11-8-12-19-16(18)13-9-6-5-7-10-13/h4-7,9-10,14H,2-3,8,11-12H2,1H3 |
| InChIKey | WRMCPNXAASWKEO-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-prop-2-enoyloxyhexyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-prop-2-enoyloxyhexyl benzoate?
The IUPAC name of 4-prop-2-enoyloxyhexyl benzoate (CID 175019274) is 4-prop-2-enoyloxyhexyl benzoate.
What is the SMILES notation for 4-prop-2-enoyloxyhexyl benzoate?
The canonical SMILES for 4-prop-2-enoyloxyhexyl benzoate is C=CC(=O)OC(CC)CCCOC(=O)c1ccccc1.
What is the InChIKey of 4-prop-2-enoyloxyhexyl benzoate?
The InChIKey is WRMCPNXAASWKEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20O4/c1-3-14(20-15(17)4-2)11-8-12-19-16(18)13-9-6-5-7-10-13/h4-7,9-10,14H,2-3,8,11-12H2,1H3.
What are the key properties of 4-prop-2-enoyloxyhexyl benzoate?
4-prop-2-enoyloxyhexyl benzoate has a molecular weight of 276.33 g/mol, XLogP of 3.13, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-prop-2-enoyloxyhexyl benzoate is sourced from PubChem (CID 175019274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).