C26H32O5 — CID 175403329
[2-methyl-3-(4-prop-2-enoyloxynonoxy)phenyl] benzoate (PubChem CID 175403329) has the molecular formula C26H32O5 and a molecular weight of 424.54 g/mol. Its IUPAC name is [2-methyl-3-(4-prop-2-enoyloxynonoxy)phenyl] benzoate.
| Compound Name | [2-methyl-3-(4-prop-2-enoyloxynonoxy)phenyl] benzoate |
|---|---|
| PubChem CID | 175403329 |
| Molecular Formula | C26H32O5 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | [2-methyl-3-(4-prop-2-enoyloxynonoxy)phenyl] benzoate |
| SMILES | C=CC(=O)OC(CCCCC)CCCOc1cccc(OC(=O)c2ccccc2)c1C |
| InChI | InChI=1S/C26H32O5/c1-4-6-8-15-22(30-25(27)5-2)16-12-19-29-23-17-11-18-24(20(23)3)31-26(28)21-13-9-7-10-14-21/h5,7,9-11,13-14,17-18,22H,2,4,6,8,12,15-16,19H2,1,3H3 |
| InChIKey | POXKQSLAUXUQMQ-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|