C40H50O9 — CID 67066856
[4-[4-(4-prop-2-enoyloxyhexoxy)benzoyl]oxyphenyl] 2-(1-hydroxyundecan-2-yloxy)benzoate (PubChem CID 67066856) has the molecular formula C40H50O9 and a molecular weight of 674.83 g/mol. Its IUPAC name is [4-[4-(4-prop-2-enoyloxyhexoxy)benzoyl]oxyphenyl] 2-(1-hydroxyundecan-2-yloxy)benzoate.
| Compound Name | [4-[4-(4-prop-2-enoyloxyhexoxy)benzoyl]oxyphenyl] 2-(1-hydroxyundecan-2-yloxy)benzoate |
|---|---|
| PubChem CID | 67066856 |
| Molecular Formula | C40H50O9 |
| Molecular Weight | 674.83 g/mol |
| Exact Mass | 674.35 |
| IUPAC Name | [4-[4-(4-prop-2-enoyloxyhexoxy)benzoyl]oxyphenyl] 2-(1-hydroxyundecan-2-yloxy)benzoate |
| SMILES | C=CC(=O)OC(CC)CCCOc1ccc(C(=O)Oc2ccc(OC(=O)c3ccccc3OC(CO)CCCCCCCCC)cc2)cc1 |
| InChI | InChI=1S/C40H50O9/c1-4-7-8-9-10-11-12-16-35(29-41)46-37-19-14-13-18-36(37)40(44)49-34-26-24-33(25-27-34)48-39(43)30-20-22-32(23-21-30)45-28-15-17-31(5-2)47-38(42)6-3/h6,13-14,18-27,31,35,41H,3-5,7-12,15-17,28-29H2,1-2H3 |
| InChIKey | AZVUWQBTDWNHPT-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.83 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|