About ethene;N-[(3-methylphenyl)methyl]aniline;molecular hydrogen
ethene;N-[(3-methylphenyl)methyl]aniline;molecular hydrogen (PubChem CID 168878317) has the molecular formula C16H21N
and a molecular weight of 227.35 g/mol. Its IUPAC name is ethene;N-[(3-methylphenyl)methyl]aniline;molecular hydrogen.
Molecular Properties
| Compound Name | ethene;N-[(3-methylphenyl)methyl]aniline;molecular hydrogen |
| PubChem CID | 168878317 |
| Molecular Formula | C16H21N |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | ethene;N-[(3-methylphenyl)methyl]aniline;molecular hydrogen |
| SMILES | C=C.Cc1cccc(CNc2ccccc2)c1.[H][H] |
| InChI | InChI=1S/C14H15N.C2H4.H2/c1-12-6-5-7-13(10-12)11-15-14-8-3-2-4-9-14;1-2;/h2-10,15H,11H2,1H3;1-2H2;1H |
| InChIKey | NFFYABLGALMVIM-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;N-[(3-methylphenyl)methyl]aniline;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;N-[(3-methylphenyl)methyl]aniline;molecular hydrogen?
The IUPAC name of ethene;N-[(3-methylphenyl)methyl]aniline;molecular hydrogen (CID 168878317) is ethene;N-[(3-methylphenyl)methyl]aniline;molecular hydrogen.
What is the SMILES notation for ethene;N-[(3-methylphenyl)methyl]aniline;molecular hydrogen?
The canonical SMILES for ethene;N-[(3-methylphenyl)methyl]aniline;molecular hydrogen is C=C.Cc1cccc(CNc2ccccc2)c1.[H][H].
What is the InChIKey of ethene;N-[(3-methylphenyl)methyl]aniline;molecular hydrogen?
The InChIKey is NFFYABLGALMVIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N.C2H4.H2/c1-12-6-5-7-13(10-12)11-15-14-8-3-2-4-9-14;1-2;/h2-10,15H,11H2,1H3;1-2H2;1H.
What are the key properties of ethene;N-[(3-methylphenyl)methyl]aniline;molecular hydrogen?
ethene;N-[(3-methylphenyl)methyl]aniline;molecular hydrogen has a molecular weight of 227.35 g/mol, XLogP of 4.66, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;N-[(3-methylphenyl)methyl]aniline;molecular hydrogen is sourced from PubChem (CID 168878317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).