About difluoromethanol;O-[(1-methylpyrrolidin-2-yl)methyl]hydroxylamine
difluoromethanol;O-[(1-methylpyrrolidin-2-yl)methyl]hydroxylamine (PubChem CID 168880743) has the molecular formula C7H16F2N2O2
and a molecular weight of 198.21 g/mol. Its IUPAC name is difluoromethanol;O-[(1-methylpyrrolidin-2-yl)methyl]hydroxylamine.
Molecular Properties
| Compound Name | difluoromethanol;O-[(1-methylpyrrolidin-2-yl)methyl]hydroxylamine |
| PubChem CID | 168880743 |
| Molecular Formula | C7H16F2N2O2 |
| Molecular Weight | 198.21 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | difluoromethanol;O-[(1-methylpyrrolidin-2-yl)methyl]hydroxylamine |
| SMILES | CN1CCCC1CON.OC(F)F |
| InChI | InChI=1S/C6H14N2O.CH2F2O/c1-8-4-2-3-6(8)5-9-7;2-1(3)4/h6H,2-5,7H2,1H3;1,4H |
| InChIKey | KPMRRMNOYBSETD-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.21 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze difluoromethanol;O-[(1-methylpyrrolidin-2-yl)methyl]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of difluoromethanol;O-[(1-methylpyrrolidin-2-yl)methyl]hydroxylamine?
The IUPAC name of difluoromethanol;O-[(1-methylpyrrolidin-2-yl)methyl]hydroxylamine (CID 168880743) is difluoromethanol;O-[(1-methylpyrrolidin-2-yl)methyl]hydroxylamine.
What is the SMILES notation for difluoromethanol;O-[(1-methylpyrrolidin-2-yl)methyl]hydroxylamine?
The canonical SMILES for difluoromethanol;O-[(1-methylpyrrolidin-2-yl)methyl]hydroxylamine is CN1CCCC1CON.OC(F)F.
What is the InChIKey of difluoromethanol;O-[(1-methylpyrrolidin-2-yl)methyl]hydroxylamine?
The InChIKey is KPMRRMNOYBSETD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2O.CH2F2O/c1-8-4-2-3-6(8)5-9-7;2-1(3)4/h6H,2-5,7H2,1H3;1,4H.
What are the key properties of difluoromethanol;O-[(1-methylpyrrolidin-2-yl)methyl]hydroxylamine?
difluoromethanol;O-[(1-methylpyrrolidin-2-yl)methyl]hydroxylamine has a molecular weight of 198.21 g/mol, XLogP of 0.17, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for difluoromethanol;O-[(1-methylpyrrolidin-2-yl)methyl]hydroxylamine is sourced from PubChem (CID 168880743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).