About [(2S)-1-methylpyrrolidin-2-yl]methyl N-ethyl-N'-methylcarbamimidate
[(2S)-1-methylpyrrolidin-2-yl]methyl N-ethyl-N'-methylcarbamimidate (PubChem CID 166822946) has the molecular formula C10H21N3O
and a molecular weight of 199.30 g/mol. Its IUPAC name is [(2S)-1-methylpyrrolidin-2-yl]methyl N-ethyl-N'-methylcarbamimidate.
Molecular Properties
| Compound Name | [(2S)-1-methylpyrrolidin-2-yl]methyl N-ethyl-N'-methylcarbamimidate |
| PubChem CID | 166822946 |
| Molecular Formula | C10H21N3O |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.17 |
| IUPAC Name | [(2S)-1-methylpyrrolidin-2-yl]methyl N-ethyl-N'-methylcarbamimidate |
| SMILES | CCN/C(=N\C)OC[C@@H]1CCCN1C |
| InChI | InChI=1S/C10H21N3O/c1-4-12-10(11-2)14-8-9-6-5-7-13(9)3/h9H,4-8H2,1-3H3,(H,11,12)/t9-/m0/s1 |
| InChIKey | WOKQDYAJKJXJCO-VIFPVBQESA-N |
| XLogP | 0.69 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-1-methylpyrrolidin-2-yl]methyl N-ethyl-N'-methylcarbamimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-1-methylpyrrolidin-2-yl]methyl N-ethyl-N'-methylcarbamimidate?
The IUPAC name of [(2S)-1-methylpyrrolidin-2-yl]methyl N-ethyl-N'-methylcarbamimidate (CID 166822946) is [(2S)-1-methylpyrrolidin-2-yl]methyl N-ethyl-N'-methylcarbamimidate.
What is the SMILES notation for [(2S)-1-methylpyrrolidin-2-yl]methyl N-ethyl-N'-methylcarbamimidate?
The canonical SMILES for [(2S)-1-methylpyrrolidin-2-yl]methyl N-ethyl-N'-methylcarbamimidate is CCN/C(=N\C)OC[C@@H]1CCCN1C.
What is the InChIKey of [(2S)-1-methylpyrrolidin-2-yl]methyl N-ethyl-N'-methylcarbamimidate?
The InChIKey is WOKQDYAJKJXJCO-VIFPVBQESA-N. The full InChI is InChI=1S/C10H21N3O/c1-4-12-10(11-2)14-8-9-6-5-7-13(9)3/h9H,4-8H2,1-3H3,(H,11,12)/t9-/m0/s1.
What are the key properties of [(2S)-1-methylpyrrolidin-2-yl]methyl N-ethyl-N'-methylcarbamimidate?
[(2S)-1-methylpyrrolidin-2-yl]methyl N-ethyl-N'-methylcarbamimidate has a molecular weight of 199.30 g/mol, XLogP of 0.69, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-1-methylpyrrolidin-2-yl]methyl N-ethyl-N'-methylcarbamimidate is sourced from PubChem (CID 166822946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).