C10H21N3O — CID 166822946
[(2S)-1-methylpyrrolidin-2-yl]methyl N-ethyl-N'-methylcarbamimidate (PubChem CID 166822946) has the molecular formula C10H21N3O and a molecular weight of 199.30 g/mol. Its IUPAC name is [(2S)-1-methylpyrrolidin-2-yl]methyl N-ethyl-N'-methylcarbamimidate.
| Compound Name | [(2S)-1-methylpyrrolidin-2-yl]methyl N-ethyl-N'-methylcarbamimidate |
|---|---|
| PubChem CID | 166822946 |
| Molecular Formula | C10H21N3O |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.17 |
| IUPAC Name | [(2S)-1-methylpyrrolidin-2-yl]methyl N-ethyl-N'-methylcarbamimidate |
| SMILES | CCN/C(=N\C)OC[C@@H]1CCCN1C |
| InChI | InChI=1S/C10H21N3O/c1-4-12-10(11-2)14-8-9-6-5-7-13(9)3/h9H,4-8H2,1-3H3,(H,11,12)/t9-/m0/s1 |
| InChIKey | WOKQDYAJKJXJCO-VIFPVBQESA-N |
| XLogP | 0.69 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|