C12H20FN3O — CID 170098116
[(2S)-1-methylpyrrolidin-2-yl]methyl N-(3-fluorobuta-1,3-dien-2-yl)-N'-methylcarbamimidate (PubChem CID 170098116) has the molecular formula C12H20FN3O and a molecular weight of 241.31 g/mol. Its IUPAC name is [(2S)-1-methylpyrrolidin-2-yl]methyl N-(3-fluorobuta-1,3-dien-2-yl)-N'-methylcarbamimidate.
| Compound Name | [(2S)-1-methylpyrrolidin-2-yl]methyl N-(3-fluorobuta-1,3-dien-2-yl)-N'-methylcarbamimidate |
|---|---|
| PubChem CID | 170098116 |
| Molecular Formula | C12H20FN3O |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | [(2S)-1-methylpyrrolidin-2-yl]methyl N-(3-fluorobuta-1,3-dien-2-yl)-N'-methylcarbamimidate |
| SMILES | C=C(F)C(=C)N/C(=N\C)OC[C@@H]1CCCN1C |
| InChI | InChI=1S/C12H20FN3O/c1-9(13)10(2)15-12(14-3)17-8-11-6-5-7-16(11)4/h11H,1-2,5-8H2,3-4H3,(H,14,15)/t11-/m0/s1 |
| InChIKey | MWYZCAIVXXPLGH-NSHDSACASA-N |
| XLogP | 1.67 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|