C11H21N3O — CID 166806948
[(2S)-1-methylpyrrolidin-2-yl]methyl N'-methyl-N-prop-1-en-2-ylcarbamimidate (PubChem CID 166806948) has the molecular formula C11H21N3O and a molecular weight of 211.31 g/mol. Its IUPAC name is [(2S)-1-methylpyrrolidin-2-yl]methyl N'-methyl-N-prop-1-en-2-ylcarbamimidate.
| Compound Name | [(2S)-1-methylpyrrolidin-2-yl]methyl N'-methyl-N-prop-1-en-2-ylcarbamimidate |
|---|---|
| PubChem CID | 166806948 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | [(2S)-1-methylpyrrolidin-2-yl]methyl N'-methyl-N-prop-1-en-2-ylcarbamimidate |
| SMILES | C=C(C)N/C(=N\C)OC[C@@H]1CCCN1C |
| InChI | InChI=1S/C11H21N3O/c1-9(2)13-11(12-3)15-8-10-6-5-7-14(10)4/h10H,1,5-8H2,2-4H3,(H,12,13)/t10-/m0/s1 |
| InChIKey | KFDGSRWUQLJNJM-JTQLQIEISA-N |
| XLogP | 1.21 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|