C33H42ClFN6O2 — CID 168880838
2-[4-[6-[3-(2-chlorophenyl)propyl]-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-5-propylpyrimidin-4-yl]-1-(2-fluoroprop-2-enoyl)piperazin-2-yl]acetonitrile (PubChem CID 168880838) has the molecular formula C33H42ClFN6O2 and a molecular weight of 609.19 g/mol. Its IUPAC name is 2-[4-[6-[3-(2-chlorophenyl)propyl]-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-5-propylpyrimidin-4-yl]-1-(2-fluoroprop-2-enoyl)piperazin-2-yl]acetonitrile.
| Compound Name | 2-[4-[6-[3-(2-chlorophenyl)propyl]-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-5-propylpyrimidin-4-yl]-1-(2-fluoroprop-2-enoyl)piperazin-2-yl]acetonitrile |
|---|---|
| PubChem CID | 168880838 |
| Molecular Formula | C33H42ClFN6O2 |
| Molecular Weight | 609.19 g/mol |
| Exact Mass | 608.30 |
| IUPAC Name | 2-[4-[6-[3-(2-chlorophenyl)propyl]-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-5-propylpyrimidin-4-yl]-1-(2-fluoroprop-2-enoyl)piperazin-2-yl]acetonitrile |
| SMILES | C=C(F)C(=O)N1CCN(c2nc(OCC34CCCN3CCC4)nc(CCCc3ccccc3Cl)c2CCC)CC1CC#N |
| InChI | InChI=1S/C33H42ClFN6O2/c1-3-9-27-29(13-6-11-25-10-4-5-12-28(25)34)37-32(43-23-33-15-7-18-40(33)19-8-16-33)38-30(27)39-20-21-41(31(42)24(2)35)26(22-39)14-17-36/h4-5,10,12,26H,2-3,6-9,11,13-16,18-23H2,1H3 |
| InChIKey | RGOKPESITKGRRP-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 85.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.19 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|