C33H37FN8O2 — CID 169323517
2-[(2S)-1-(2-fluoroprop-2-enoyl)-4-[2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-7-(5,6,7,8-tetrahydroisoquinolin-4-yl)pyrido[2,3-d]pyrimidin-4-yl]piperazin-2-yl]acetonitrile (PubChem CID 169323517) has the molecular formula C33H37FN8O2 and a molecular weight of 596.71 g/mol. Its IUPAC name is 2-[(2S)-1-(2-fluoroprop-2-enoyl)-4-[2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-7-(5,6,7,8-tetrahydroisoquinolin-4-yl)pyrido[2,3-d]pyrimidin-4-yl]piperazin-2-yl]acetonitrile.
| Compound Name | 2-[(2S)-1-(2-fluoroprop-2-enoyl)-4-[2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-7-(5,6,7,8-tetrahydroisoquinolin-4-yl)pyrido[2,3-d]pyrimidin-4-yl]piperazin-2-yl]acetonitrile |
|---|---|
| PubChem CID | 169323517 |
| Molecular Formula | C33H37FN8O2 |
| Molecular Weight | 596.71 g/mol |
| Exact Mass | 596.30 |
| IUPAC Name | 2-[(2S)-1-(2-fluoroprop-2-enoyl)-4-[2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-7-(5,6,7,8-tetrahydroisoquinolin-4-yl)pyrido[2,3-d]pyrimidin-4-yl]piperazin-2-yl]acetonitrile |
| SMILES | C=C(F)C(=O)N1CCN(c2nc(OCC34CCCN3CCC4)nc3nc(-c4cncc5c4CCCC5)ccc23)C[C@@H]1CC#N |
| InChI | InChI=1S/C33H37FN8O2/c1-22(34)31(43)42-17-16-40(20-24(42)10-13-35)30-26-8-9-28(27-19-36-18-23-6-2-3-7-25(23)27)37-29(26)38-32(39-30)44-21-33-11-4-14-41(33)15-5-12-33/h8-9,18-19,24H,1-7,10-12,14-17,20-21H2/t24-/m0/s1 |
| InChIKey | IFWHTXJGXBNJKB-DEOSSOPVSA-N |
| XLogP | 4.39 |
| TPSA | 111.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.71 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|