C10H22N2O — CID 168880957
2-(methoxymethyl)-N,N,1-trimethylpiperidin-4-amine (PubChem CID 168880957) has the molecular formula C10H22N2O and a molecular weight of 186.30 g/mol. Its IUPAC name is 2-(methoxymethyl)-N,N,1-trimethylpiperidin-4-amine.
| Compound Name | 2-(methoxymethyl)-N,N,1-trimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 168880957 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | 2-(methoxymethyl)-N,N,1-trimethylpiperidin-4-amine |
| SMILES | COCC1CC(N(C)C)CCN1C |
| InChI | InChI=1S/C10H22N2O/c1-11(2)9-5-6-12(3)10(7-9)8-13-4/h9-10H,5-8H2,1-4H3 |
| InChIKey | LLXCCZAMZKRTIF-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |