C13H30I2N2O — CID 3030685
2-[(1,1-dimethylpiperidin-1-ium-2-yl)methoxy]ethyl-trimethylazanium diiodide (PubChem CID 3030685) has the molecular formula C13H30I2N2O and a molecular weight of 484.20 g/mol. Its IUPAC name is 2-[(1,1-dimethylpiperidin-1-ium-2-yl)methoxy]ethyl-trimethylazanium diiodide.
| Compound Name | 2-[(1,1-dimethylpiperidin-1-ium-2-yl)methoxy]ethyl-trimethylazanium diiodide |
|---|---|
| PubChem CID | 3030685 |
| Molecular Formula | C13H30I2N2O |
| Molecular Weight | 484.20 g/mol |
| Exact Mass | 484.04 |
| IUPAC Name | 2-[(1,1-dimethylpiperidin-1-ium-2-yl)methoxy]ethyl-trimethylazanium diiodide |
| SMILES | C[N+](C)(C)CCOCC1CCCC[N+]1(C)C.[I-].[I-] |
| InChI | InChI=1S/C13H30N2O.2HI/c1-14(2,3)10-11-16-12-13-8-6-7-9-15(13,4)5;;/h13H,6-12H2,1-5H3;2*1H/q+2;;/p-2 |
| InChIKey | WNWNNAMPUXDXEO-UHFFFAOYSA-L |
| XLogP | -4.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.20 |
| LogP ≤ 5 | -4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|